C5H4F5N3O2S — CID 54223785
1,1,2,2,2-pentafluoro-N-pyrazol-1-ylethanesulfonamide (PubChem CID 54223785) has the molecular formula C5H4F5N3O2S and a molecular weight of 265.16 g/mol. Its IUPAC name is 1,1,2,2,2-pentafluoro-N-pyrazol-1-ylethanesulfonamide.
| Compound Name | 1,1,2,2,2-pentafluoro-N-pyrazol-1-ylethanesulfonamide |
|---|---|
| PubChem CID | 54223785 |
| Molecular Formula | C5H4F5N3O2S |
| Molecular Weight | 265.16 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | 1,1,2,2,2-pentafluoro-N-pyrazol-1-ylethanesulfonamide |
| SMILES | O=S(=O)(Nn1cccn1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H4F5N3O2S/c6-4(7,8)5(9,10)16(14,15)12-13-3-1-2-11-13/h1-3,12H |
| InChIKey | QELGOPSDCGRHOU-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.16 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|