C15H17BrN2O2 — CID 54224006
ethyl 4-(5-bromo-3-pyridinyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate (PubChem CID 54224006) has the molecular formula C15H17BrN2O2 and a molecular weight of 337.22 g/mol. Its IUPAC name is ethyl 4-(5-bromo-3-pyridinyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate.
| Compound Name | ethyl 4-(5-bromo-3-pyridinyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 54224006 |
| Molecular Formula | C15H17BrN2O2 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | ethyl 4-(5-bromo-3-pyridinyl)-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
| SMILES | CCOC(=O)N1C2C=CC(c3cncc(Br)c3)C1CC2 |
| InChI | InChI=1S/C15H17BrN2O2/c1-2-20-15(19)18-12-3-5-13(14(18)6-4-12)10-7-11(16)9-17-8-10/h3,5,7-9,12-14H,2,4,6H2,1H3 |
| InChIKey | QEPAORNMOJQZSC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|