About methyl 3-ethyliminobutanoate
methyl 3-ethyliminobutanoate (PubChem CID 54224289) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is methyl 3-ethyliminobutanoate.
Molecular Properties
| Compound Name | methyl 3-ethyliminobutanoate |
| PubChem CID | 54224289 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | methyl 3-ethyliminobutanoate |
| SMILES | CC/N=C(\C)CC(=O)OC |
| InChI | InChI=1S/C7H13NO2/c1-4-8-6(2)5-7(9)10-3/h4-5H2,1-3H3/b8-6+ |
| InChIKey | QETQPGPDRMIVPM-SOFGYWHQSA-N |
| XLogP | 1.03 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-ethyliminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-ethyliminobutanoate?
The IUPAC name of methyl 3-ethyliminobutanoate (CID 54224289) is methyl 3-ethyliminobutanoate.
What is the SMILES notation for methyl 3-ethyliminobutanoate?
The canonical SMILES for methyl 3-ethyliminobutanoate is CC/N=C(\C)CC(=O)OC.
What is the InChIKey of methyl 3-ethyliminobutanoate?
The InChIKey is QETQPGPDRMIVPM-SOFGYWHQSA-N. The full InChI is InChI=1S/C7H13NO2/c1-4-8-6(2)5-7(9)10-3/h4-5H2,1-3H3/b8-6+.
What are the key properties of methyl 3-ethyliminobutanoate?
methyl 3-ethyliminobutanoate has a molecular weight of 143.19 g/mol, XLogP of 1.03, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-ethyliminobutanoate is sourced from PubChem (CID 54224289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).