C5H3ClN2O2S3 — CID 54224819
6-chloro-1,1-dioxo-4H-thieno[3,2-e][1,2,4]thiadiazine-3-thione (PubChem CID 54224819) has the molecular formula C5H3ClN2O2S3 and a molecular weight of 254.75 g/mol. Its IUPAC name is 6-chloro-1,1-dioxo-4H-thieno[3,2-e][1,2,4]thiadiazine-3-thione.
| Compound Name | 6-chloro-1,1-dioxo-4H-thieno[3,2-e][1,2,4]thiadiazine-3-thione |
|---|---|
| PubChem CID | 54224819 |
| Molecular Formula | C5H3ClN2O2S3 |
| Molecular Weight | 254.75 g/mol |
| Exact Mass | 253.90 |
| IUPAC Name | 6-chloro-1,1-dioxo-4H-thieno[3,2-e][1,2,4]thiadiazine-3-thione |
| SMILES | O=S1(=O)NC(=S)Nc2cc(Cl)sc21 |
| InChI | InChI=1S/C5H3ClN2O2S3/c6-3-1-2-4(12-3)13(9,10)8-5(11)7-2/h1H,(H2,7,8,11) |
| InChIKey | QFCNCWOGEYOSJV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.75 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|