C18H12F7N3O3 — CID 54225106
ethyl 2-[6-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy]benzotriazol-1-yl]propanoate (PubChem CID 54225106) has the molecular formula C18H12F7N3O3 and a molecular weight of 451.30 g/mol. Its IUPAC name is ethyl 2-[6-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy]benzotriazol-1-yl]propanoate.
| Compound Name | ethyl 2-[6-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy]benzotriazol-1-yl]propanoate |
|---|---|
| PubChem CID | 54225106 |
| Molecular Formula | C18H12F7N3O3 |
| Molecular Weight | 451.30 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | ethyl 2-[6-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy]benzotriazol-1-yl]propanoate |
| SMILES | CCOC(=O)C(C)n1nnc2ccc(Oc3c(F)c(F)c(C(F)(F)F)c(F)c3F)cc21 |
| InChI | InChI=1S/C18H12F7N3O3/c1-3-30-17(29)7(2)28-10-6-8(4-5-9(10)26-27-28)31-16-14(21)12(19)11(18(23,24)25)13(20)15(16)22/h4-7H,3H2,1-2H3 |
| InChIKey | QFHMYRJUMASRCK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.30 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|