About 3-cyclohexa-1,4-dien-1-yl-2-methoxyprop-2-enoic acid
3-cyclohexa-1,4-dien-1-yl-2-methoxyprop-2-enoic acid (PubChem CID 54225191) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 3-cyclohexa-1,4-dien-1-yl-2-methoxyprop-2-enoic acid.
Molecular Properties
| Compound Name | 3-cyclohexa-1,4-dien-1-yl-2-methoxyprop-2-enoic acid |
| PubChem CID | 54225191 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 3-cyclohexa-1,4-dien-1-yl-2-methoxyprop-2-enoic acid |
| SMILES | COC(=CC1=CCC=CC1)C(=O)O |
| InChI | InChI=1S/C10H12O3/c1-13-9(10(11)12)7-8-5-3-2-4-6-8/h2-3,6-7H,4-5H2,1H3,(H,11,12) |
| InChIKey | QFIXQSJZLQDRSW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexa-1,4-dien-1-yl-2-methoxyprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexa-1,4-dien-1-yl-2-methoxyprop-2-enoic acid?
The IUPAC name of 3-cyclohexa-1,4-dien-1-yl-2-methoxyprop-2-enoic acid (CID 54225191) is 3-cyclohexa-1,4-dien-1-yl-2-methoxyprop-2-enoic acid.
What is the SMILES notation for 3-cyclohexa-1,4-dien-1-yl-2-methoxyprop-2-enoic acid?
The canonical SMILES for 3-cyclohexa-1,4-dien-1-yl-2-methoxyprop-2-enoic acid is COC(=CC1=CCC=CC1)C(=O)O.
What is the InChIKey of 3-cyclohexa-1,4-dien-1-yl-2-methoxyprop-2-enoic acid?
The InChIKey is QFIXQSJZLQDRSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-13-9(10(11)12)7-8-5-3-2-4-6-8/h2-3,6-7H,4-5H2,1H3,(H,11,12).
What are the key properties of 3-cyclohexa-1,4-dien-1-yl-2-methoxyprop-2-enoic acid?
3-cyclohexa-1,4-dien-1-yl-2-methoxyprop-2-enoic acid has a molecular weight of 180.20 g/mol, XLogP of 1.88, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexa-1,4-dien-1-yl-2-methoxyprop-2-enoic acid is sourced from PubChem (CID 54225191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).