C25H33NO2 — CID 54225549
2-[5-(hydroxymethyl)-2,2,4,7,8-pentamethyl-1H-quinolin-6-yl]-3,4,5,6-tetramethylphenol (PubChem CID 54225549) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is 2-[5-(hydroxymethyl)-2,2,4,7,8-pentamethyl-1H-quinolin-6-yl]-3,4,5,6-tetramethylphenol.
| Compound Name | 2-[5-(hydroxymethyl)-2,2,4,7,8-pentamethyl-1H-quinolin-6-yl]-3,4,5,6-tetramethylphenol |
|---|---|
| PubChem CID | 54225549 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 2-[5-(hydroxymethyl)-2,2,4,7,8-pentamethyl-1H-quinolin-6-yl]-3,4,5,6-tetramethylphenol |
| SMILES | CC1=CC(C)(C)Nc2c(C)c(C)c(-c3c(C)c(C)c(C)c(C)c3O)c(CO)c21 |
| InChI | InChI=1S/C25H33NO2/c1-12-10-25(8,9)26-23-17(6)16(5)21(19(11-27)20(12)23)22-15(4)13(2)14(3)18(7)24(22)28/h10,26-28H,11H2,1-9H3 |
| InChIKey | QFPCGGUFICLCRE-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |