C9H15BrFNO — CID 54226526
(4R)-4-(3-bromo-2-fluoroprop-1-enyl)-2,2,3-trimethyl-1,3-oxazolidine (PubChem CID 54226526) has the molecular formula C9H15BrFNO and a molecular weight of 252.13 g/mol. Its IUPAC name is (4R)-4-(3-bromo-2-fluoroprop-1-enyl)-2,2,3-trimethyl-1,3-oxazolidine.
| Compound Name | (4R)-4-(3-bromo-2-fluoroprop-1-enyl)-2,2,3-trimethyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 54226526 |
| Molecular Formula | C9H15BrFNO |
| Molecular Weight | 252.13 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | (4R)-4-(3-bromo-2-fluoroprop-1-enyl)-2,2,3-trimethyl-1,3-oxazolidine |
| SMILES | CN1[C@H](C=C(F)CBr)COC1(C)C |
| InChI | InChI=1S/C9H15BrFNO/c1-9(2)12(3)8(6-13-9)4-7(11)5-10/h4,8H,5-6H2,1-3H3/t8-/m1/s1 |
| InChIKey | QGGAOFUCPALIOQ-MRVPVSSYSA-N |
| XLogP | 2.30 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.13 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|