C8H10N2O4 — CID 54226789
1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-6-carboxylic acid (PubChem CID 54226789) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is 1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-6-carboxylic acid.
| Compound Name | 1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-6-carboxylic acid |
|---|---|
| PubChem CID | 54226789 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-6-carboxylic acid |
| SMILES | O=C(O)C1CCC2C(=O)NCC(=O)N12 |
| InChI | InChI=1S/C8H10N2O4/c11-6-3-9-7(12)4-1-2-5(8(13)14)10(4)6/h4-5H,1-3H2,(H,9,12)(H,13,14) |
| InChIKey | QGKBMSZZKDSBIR-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |