C8H10N2O — CID 54227305
3,4,5,6-tetrahydro-1H-quinazolin-2-one (PubChem CID 54227305) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 3,4,5,6-tetrahydro-1H-quinazolin-2-one.
| Compound Name | 3,4,5,6-tetrahydro-1H-quinazolin-2-one |
|---|---|
| PubChem CID | 54227305 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 3,4,5,6-tetrahydro-1H-quinazolin-2-one |
| SMILES | O=C1NCC2=C(C=CCC2)N1 |
| InChI | InChI=1S/C8H10N2O/c11-8-9-5-6-3-1-2-4-7(6)10-8/h2,4H,1,3,5H2,(H2,9,10,11) |
| InChIKey | QGTKNFOUQNBRSN-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |