C11H14O3 — CID 54227527
1,5,5-trimethylbicyclo[4.2.0]octane-3,4,7-trione (PubChem CID 54227527) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 1,5,5-trimethylbicyclo[4.2.0]octane-3,4,7-trione.
| Compound Name | 1,5,5-trimethylbicyclo[4.2.0]octane-3,4,7-trione |
|---|---|
| PubChem CID | 54227527 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1,5,5-trimethylbicyclo[4.2.0]octane-3,4,7-trione |
| SMILES | CC12CC(=O)C(=O)C(C)(C)C1C(=O)C2 |
| InChI | InChI=1S/C11H14O3/c1-10(2)8-6(12)4-11(8,3)5-7(13)9(10)14/h8H,4-5H2,1-3H3 |
| InChIKey | QGXOCOGHIDAJHD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|