About 2,3-diiminoquinoline-7,8-dicarbonitrile
2,3-diiminoquinoline-7,8-dicarbonitrile (PubChem CID 54227804) has the molecular formula C11H5N5
and a molecular weight of 207.20 g/mol. Its IUPAC name is 2,3-diiminoquinoline-7,8-dicarbonitrile.
Molecular Properties
| Compound Name | 2,3-diiminoquinoline-7,8-dicarbonitrile |
| PubChem CID | 54227804 |
| Molecular Formula | C11H5N5 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 2,3-diiminoquinoline-7,8-dicarbonitrile |
| SMILES | [H]/N=C1\N=c2c(C#N)c(C#N)ccc2=C\C1=N/[H] |
| InChI | InChI=1S/C11H5N5/c12-4-7-2-1-6-3-9(14)11(15)16-10(6)8(7)5-13/h1-3,14-15H/b14-9+,15-11- |
| InChIKey | QHCBSHVTSABKLY-PVMFERMNSA-N |
| XLogP | -0.16 |
| TPSA | 107.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diiminoquinoline-7,8-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diiminoquinoline-7,8-dicarbonitrile?
The IUPAC name of 2,3-diiminoquinoline-7,8-dicarbonitrile (CID 54227804) is 2,3-diiminoquinoline-7,8-dicarbonitrile.
What is the SMILES notation for 2,3-diiminoquinoline-7,8-dicarbonitrile?
The canonical SMILES for 2,3-diiminoquinoline-7,8-dicarbonitrile is [H]/N=C1\N=c2c(C#N)c(C#N)ccc2=C\C1=N/[H].
What is the InChIKey of 2,3-diiminoquinoline-7,8-dicarbonitrile?
The InChIKey is QHCBSHVTSABKLY-PVMFERMNSA-N. The full InChI is InChI=1S/C11H5N5/c12-4-7-2-1-6-3-9(14)11(15)16-10(6)8(7)5-13/h1-3,14-15H/b14-9+,15-11-.
What are the key properties of 2,3-diiminoquinoline-7,8-dicarbonitrile?
2,3-diiminoquinoline-7,8-dicarbonitrile has a molecular weight of 207.20 g/mol, XLogP of -0.16, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diiminoquinoline-7,8-dicarbonitrile is sourced from PubChem (CID 54227804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).