C32H37FN2O4 — CID 54227817
2,2-diethyl-4-[3-[2-[6-[4-(4-fluorophenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]-4-oxobutanoic acid (PubChem CID 54227817) has the molecular formula C32H37FN2O4 and a molecular weight of 532.66 g/mol. Its IUPAC name is 2,2-diethyl-4-[3-[2-[6-[4-(4-fluorophenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]-4-oxobutanoic acid.
| Compound Name | 2,2-diethyl-4-[3-[2-[6-[4-(4-fluorophenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54227817 |
| Molecular Formula | C32H37FN2O4 |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | 2,2-diethyl-4-[3-[2-[6-[4-(4-fluorophenyl)butoxymethyl]-2-pyridinyl]ethenyl]anilino]-4-oxobutanoic acid |
| SMILES | CCC(CC)(CC(=O)Nc1cccc(C=Cc2cccc(COCCCCc3ccc(F)cc3)n2)c1)C(=O)O |
| InChI | InChI=1S/C32H37FN2O4/c1-3-32(4-2,31(37)38)22-30(36)35-28-12-7-10-25(21-28)16-19-27-11-8-13-29(34-27)23-39-20-6-5-9-24-14-17-26(33)18-15-24/h7-8,10-19,21H,3-6,9,20,22-23H2,1-2H3,(H,35,36)(H,37,38) |
| InChIKey | QHCGYPDERXGFEA-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|