About 2-ethyl-4,5-dihydroisoindole-1,3-diol
2-ethyl-4,5-dihydroisoindole-1,3-diol (PubChem CID 54228299) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 2-ethyl-4,5-dihydroisoindole-1,3-diol.
Molecular Properties
| Compound Name | 2-ethyl-4,5-dihydroisoindole-1,3-diol |
| PubChem CID | 54228299 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 2-ethyl-4,5-dihydroisoindole-1,3-diol |
| SMILES | CCn1c(O)c2c(c1O)CCC=C2 |
| InChI | InChI=1S/C10H13NO2/c1-2-11-9(12)7-5-3-4-6-8(7)10(11)13/h3,5,12-13H,2,4,6H2,1H3 |
| InChIKey | LSIXQQRBRLVPED-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-4,5-dihydroisoindole-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4,5-dihydroisoindole-1,3-diol?
The IUPAC name of 2-ethyl-4,5-dihydroisoindole-1,3-diol (CID 54228299) is 2-ethyl-4,5-dihydroisoindole-1,3-diol.
What is the SMILES notation for 2-ethyl-4,5-dihydroisoindole-1,3-diol?
The canonical SMILES for 2-ethyl-4,5-dihydroisoindole-1,3-diol is CCn1c(O)c2c(c1O)CCC=C2.
What is the InChIKey of 2-ethyl-4,5-dihydroisoindole-1,3-diol?
The InChIKey is LSIXQQRBRLVPED-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-2-11-9(12)7-5-3-4-6-8(7)10(11)13/h3,5,12-13H,2,4,6H2,1H3.
What are the key properties of 2-ethyl-4,5-dihydroisoindole-1,3-diol?
2-ethyl-4,5-dihydroisoindole-1,3-diol has a molecular weight of 179.22 g/mol, XLogP of 1.88, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4,5-dihydroisoindole-1,3-diol is sourced from PubChem (CID 54228299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).