About (4-heptylphenyl) 1,4-diamino-9,10-dioxoanthracene-2-carboxylate
(4-heptylphenyl) 1,4-diamino-9,10-dioxoanthracene-2-carboxylate (PubChem CID 54228404) has the molecular formula C28H28N2O4
and a molecular weight of 456.54 g/mol. Its IUPAC name is (4-heptylphenyl) 1,4-diamino-9,10-dioxoanthracene-2-carboxylate.
Molecular Properties
| Compound Name | (4-heptylphenyl) 1,4-diamino-9,10-dioxoanthracene-2-carboxylate |
| PubChem CID | 54228404 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | (4-heptylphenyl) 1,4-diamino-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CCCCCCCc1ccc(OC(=O)c2cc(N)c3c(c2N)C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C28H28N2O4/c1-2-3-4-5-6-9-17-12-14-18(15-13-17)34-28(33)21-16-22(29)23-24(25(21)30)27(32)20-11-8-7-10-19(20)26(23)31/h7-8,10-16H,2-6,9,29-30H2,1H3 |
| InChIKey | QHMHMNHAYYODQR-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-heptylphenyl) 1,4-diamino-9,10-dioxoanthracene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-heptylphenyl) 1,4-diamino-9,10-dioxoanthracene-2-carboxylate?
The IUPAC name of (4-heptylphenyl) 1,4-diamino-9,10-dioxoanthracene-2-carboxylate (CID 54228404) is (4-heptylphenyl) 1,4-diamino-9,10-dioxoanthracene-2-carboxylate.
What is the SMILES notation for (4-heptylphenyl) 1,4-diamino-9,10-dioxoanthracene-2-carboxylate?
The canonical SMILES for (4-heptylphenyl) 1,4-diamino-9,10-dioxoanthracene-2-carboxylate is CCCCCCCc1ccc(OC(=O)c2cc(N)c3c(c2N)C(=O)c2ccccc2C3=O)cc1.
What is the InChIKey of (4-heptylphenyl) 1,4-diamino-9,10-dioxoanthracene-2-carboxylate?
The InChIKey is QHMHMNHAYYODQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28N2O4/c1-2-3-4-5-6-9-17-12-14-18(15-13-17)34-28(33)21-16-22(29)23-24(25(21)30)27(32)20-11-8-7-10-19(20)26(23)31/h7-8,10-16H,2-6,9,29-30H2,1H3.
What are the key properties of (4-heptylphenyl) 1,4-diamino-9,10-dioxoanthracene-2-carboxylate?
(4-heptylphenyl) 1,4-diamino-9,10-dioxoanthracene-2-carboxylate has a molecular weight of 456.54 g/mol, XLogP of 5.36, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-heptylphenyl) 1,4-diamino-9,10-dioxoanthracene-2-carboxylate is sourced from PubChem (CID 54228404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).