C18H18O4 — CID 54228602
8-methyl-7,11-dioxatricyclo[10.2.2.23,6]octadeca-1(14),3(18),4,6(17),12,15-hexaene-2-carboxylic acid (PubChem CID 54228602) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 8-methyl-7,11-dioxatricyclo[10.2.2.23,6]octadeca-1(14),3(18),4,6(17),12,15-hexaene-2-carboxylic acid.
| Compound Name | 8-methyl-7,11-dioxatricyclo[10.2.2.23,6]octadeca-1(14),3(18),4,6(17),12,15-hexaene-2-carboxylic acid |
|---|---|
| PubChem CID | 54228602 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 8-methyl-7,11-dioxatricyclo[10.2.2.23,6]octadeca-1(14),3(18),4,6(17),12,15-hexaene-2-carboxylic acid |
| SMILES | CC1CCOc2ccc(cc2)C(C(=O)O)c2ccc(cc2)O1 |
| InChI | InChI=1S/C18H18O4/c1-12-10-11-21-15-6-2-13(3-7-15)17(18(19)20)14-4-8-16(22-12)9-5-14/h2-9,12,17H,10-11H2,1H3,(H,19,20) |
| InChIKey | QHPNSFFODUMVRI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |