About 2-fluorobut-2-enal
2-fluorobut-2-enal (PubChem CID 54228963) has the molecular formula C4H5FO
and a molecular weight of 88.08 g/mol. Its IUPAC name is 2-fluorobut-2-enal.
Molecular Properties
| Compound Name | 2-fluorobut-2-enal |
| PubChem CID | 54228963 |
| Molecular Formula | C4H5FO |
| Molecular Weight | 88.08 g/mol |
| Exact Mass | 88.03 |
| IUPAC Name | 2-fluorobut-2-enal |
| SMILES | CC=C(F)C=O |
| InChI | InChI=1S/C4H5FO/c1-2-4(5)3-6/h2-3H,1H3 |
| InChIKey | QHVYVQRIAQVFIB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.08 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-fluorobut-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluorobut-2-enal?
The IUPAC name of 2-fluorobut-2-enal (CID 54228963) is 2-fluorobut-2-enal.
What is the SMILES notation for 2-fluorobut-2-enal?
The canonical SMILES for 2-fluorobut-2-enal is CC=C(F)C=O.
What is the InChIKey of 2-fluorobut-2-enal?
The InChIKey is QHVYVQRIAQVFIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5FO/c1-2-4(5)3-6/h2-3H,1H3.
What are the key properties of 2-fluorobut-2-enal?
2-fluorobut-2-enal has a molecular weight of 88.08 g/mol, XLogP of 1.06, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluorobut-2-enal is sourced from PubChem (CID 54228963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).