C26H34N4O3 — CID 54229944
methyl 2-[4-[[4-(4-benzylpiperazin-1-yl)benzoyl]amino]piperidin-1-yl]acetate (PubChem CID 54229944) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is methyl 2-[4-[[4-(4-benzylpiperazin-1-yl)benzoyl]amino]piperidin-1-yl]acetate.
| Compound Name | methyl 2-[4-[[4-(4-benzylpiperazin-1-yl)benzoyl]amino]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 54229944 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | methyl 2-[4-[[4-(4-benzylpiperazin-1-yl)benzoyl]amino]piperidin-1-yl]acetate |
| SMILES | COC(=O)CN1CCC(NC(=O)c2ccc(N3CCN(Cc4ccccc4)CC3)cc2)CC1 |
| InChI | InChI=1S/C26H34N4O3/c1-33-25(31)20-28-13-11-23(12-14-28)27-26(32)22-7-9-24(10-8-22)30-17-15-29(16-18-30)19-21-5-3-2-4-6-21/h2-10,23H,11-20H2,1H3,(H,27,32) |
| InChIKey | QINWKUPKGYFNRX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |