About 7,7a-dihydro-1aH-oxireno[2,3-b]chromene
7,7a-dihydro-1aH-oxireno[2,3-b]chromene (PubChem CID 54230877) has the molecular formula C9H8O2
and a molecular weight of 148.16 g/mol. Its IUPAC name is 7,7a-dihydro-1aH-oxireno[2,3-b]chromene.
Molecular Properties
| Compound Name | 7,7a-dihydro-1aH-oxireno[2,3-b]chromene |
| PubChem CID | 54230877 |
| Molecular Formula | C9H8O2 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | 7,7a-dihydro-1aH-oxireno[2,3-b]chromene |
| SMILES | c1ccc2c(c1)CC1OC1O2 |
| InChI | InChI=1S/C9H8O2/c1-2-4-7-6(3-1)5-8-9(10-7)11-8/h1-4,8-9H,5H2 |
| InChIKey | QJEHIPIWRZLUBV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 7,7a-dihydro-1aH-oxireno[2,3-b]chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7a-dihydro-1aH-oxireno[2,3-b]chromene?
The IUPAC name of 7,7a-dihydro-1aH-oxireno[2,3-b]chromene (CID 54230877) is 7,7a-dihydro-1aH-oxireno[2,3-b]chromene.
What is the SMILES notation for 7,7a-dihydro-1aH-oxireno[2,3-b]chromene?
The canonical SMILES for 7,7a-dihydro-1aH-oxireno[2,3-b]chromene is c1ccc2c(c1)CC1OC1O2.
What is the InChIKey of 7,7a-dihydro-1aH-oxireno[2,3-b]chromene?
The InChIKey is QJEHIPIWRZLUBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2/c1-2-4-7-6(3-1)5-8-9(10-7)11-8/h1-4,8-9H,5H2.
What are the key properties of 7,7a-dihydro-1aH-oxireno[2,3-b]chromene?
7,7a-dihydro-1aH-oxireno[2,3-b]chromene has a molecular weight of 148.16 g/mol, XLogP of 1.35, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7a-dihydro-1aH-oxireno[2,3-b]chromene is sourced from PubChem (CID 54230877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).