C23H40O3 — CID 54231009
trans-pentyl (1R,4R)-2-oxo-4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 54231009) has the molecular formula C23H40O3 and a molecular weight of 364.57 g/mol. Its IUPAC name is trans-pentyl (1R,4R)-2-oxo-4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | trans-pentyl (1R,4R)-2-oxo-4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54231009 |
| Molecular Formula | C23H40O3 |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.30 |
| IUPAC Name | trans-pentyl (1R,4R)-2-oxo-4-(4-pentylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCOC(=O)[C@@H]1CC[C@@H](C2CCC(CCCCC)CC2)CC1=O |
| InChI | InChI=1S/C23H40O3/c1-3-5-7-9-18-10-12-19(13-11-18)20-14-15-21(22(24)17-20)23(25)26-16-8-6-4-2/h18-21H,3-17H2,1-2H3/t18?,19?,20-,21-/m1/s1 |
| InChIKey | QJGIBXYQTJGPET-TZWRJOPASA-N |
| XLogP | 6.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|