C10H20O4 — CID 54231023
3,7-dimethyloct-3-ene-1,2,6,7-tetrol (PubChem CID 54231023) has the molecular formula C10H20O4 and a molecular weight of 204.27 g/mol. Its IUPAC name is 3,7-dimethyloct-3-ene-1,2,6,7-tetrol.
| Compound Name | 3,7-dimethyloct-3-ene-1,2,6,7-tetrol |
|---|---|
| PubChem CID | 54231023 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 3,7-dimethyloct-3-ene-1,2,6,7-tetrol |
| SMILES | CC(=CCC(O)C(C)(C)O)C(O)CO |
| InChI | InChI=1S/C10H20O4/c1-7(8(12)6-11)4-5-9(13)10(2,3)14/h4,8-9,11-14H,5-6H2,1-3H3 |
| InChIKey | QJGNMNVVLILWRD-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|