C28H44N2O4 — CID 54231034
[4-[2-(2,2,6,6-tetramethylpiperidin-1-yl)acetyl]oxyphenyl] 2-(2,2,6,6-tetramethylpiperidin-1-yl)acetate (PubChem CID 54231034) has the molecular formula C28H44N2O4 and a molecular weight of 472.67 g/mol. Its IUPAC name is [4-[2-(2,2,6,6-tetramethylpiperidin-1-yl)acetyl]oxyphenyl] 2-(2,2,6,6-tetramethylpiperidin-1-yl)acetate.
| Compound Name | [4-[2-(2,2,6,6-tetramethylpiperidin-1-yl)acetyl]oxyphenyl] 2-(2,2,6,6-tetramethylpiperidin-1-yl)acetate |
|---|---|
| PubChem CID | 54231034 |
| Molecular Formula | C28H44N2O4 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.33 |
| IUPAC Name | [4-[2-(2,2,6,6-tetramethylpiperidin-1-yl)acetyl]oxyphenyl] 2-(2,2,6,6-tetramethylpiperidin-1-yl)acetate |
| SMILES | CC1(C)CCCC(C)(C)N1CC(=O)Oc1ccc(OC(=O)CN2C(C)(C)CCCC2(C)C)cc1 |
| InChI | InChI=1S/C28H44N2O4/c1-25(2)15-9-16-26(3,4)29(25)19-23(31)33-21-11-13-22(14-12-21)34-24(32)20-30-27(5,6)17-10-18-28(30,7)8/h11-14H,9-10,15-20H2,1-8H3 |
| InChIKey | QJGUWXIZESKRPV-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|