About ethyl (4R)-2-methyl-1,3-thiazolidine-4-carboxylate
ethyl (4R)-2-methyl-1,3-thiazolidine-4-carboxylate (PubChem CID 54231762) has the molecular formula C7H13NO2S
and a molecular weight of 175.25 g/mol. Its IUPAC name is ethyl (4R)-2-methyl-1,3-thiazolidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl (4R)-2-methyl-1,3-thiazolidine-4-carboxylate |
| PubChem CID | 54231762 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | ethyl (4R)-2-methyl-1,3-thiazolidine-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CSC(C)N1 |
| InChI | InChI=1S/C7H13NO2S/c1-3-10-7(9)6-4-11-5(2)8-6/h5-6,8H,3-4H2,1-2H3/t5?,6-/m0/s1 |
| InChIKey | QJUCAYHPLVZBJP-GDVGLLTNSA-N |
| XLogP | 0.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (4R)-2-methyl-1,3-thiazolidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (4R)-2-methyl-1,3-thiazolidine-4-carboxylate?
The IUPAC name of ethyl (4R)-2-methyl-1,3-thiazolidine-4-carboxylate (CID 54231762) is ethyl (4R)-2-methyl-1,3-thiazolidine-4-carboxylate.
What is the SMILES notation for ethyl (4R)-2-methyl-1,3-thiazolidine-4-carboxylate?
The canonical SMILES for ethyl (4R)-2-methyl-1,3-thiazolidine-4-carboxylate is CCOC(=O)[C@@H]1CSC(C)N1.
What is the InChIKey of ethyl (4R)-2-methyl-1,3-thiazolidine-4-carboxylate?
The InChIKey is QJUCAYHPLVZBJP-GDVGLLTNSA-N. The full InChI is InChI=1S/C7H13NO2S/c1-3-10-7(9)6-4-11-5(2)8-6/h5-6,8H,3-4H2,1-2H3/t5?,6-/m0/s1.
What are the key properties of ethyl (4R)-2-methyl-1,3-thiazolidine-4-carboxylate?
ethyl (4R)-2-methyl-1,3-thiazolidine-4-carboxylate has a molecular weight of 175.25 g/mol, XLogP of 0.60, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (4R)-2-methyl-1,3-thiazolidine-4-carboxylate is sourced from PubChem (CID 54231762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).