C55H108NO3+ — CID 54232076
tris[(12R)-12-hydroxyoctadec-9-enyl]-methylazanium (PubChem CID 54232076) has the molecular formula C55H108NO3+ and a molecular weight of 831.47 g/mol. Its IUPAC name is tris[(12R)-12-hydroxyoctadec-9-enyl]-methylazanium.
| Compound Name | tris[(12R)-12-hydroxyoctadec-9-enyl]-methylazanium |
|---|---|
| PubChem CID | 54232076 |
| Molecular Formula | C55H108NO3+ |
| Molecular Weight | 831.47 g/mol |
| Exact Mass | 830.83 |
| IUPAC Name | tris[(12R)-12-hydroxyoctadec-9-enyl]-methylazanium |
| SMILES | CCCCCC[C@@H](O)CC=CCCCCCCCC[N+](C)(CCCCCCCCC=CC[C@H](O)CCCCCC)CCCCCCCCC=CC[C@H](O)CCCCCC |
| InChI | InChI=1S/C55H108NO3/c1-5-8-11-35-44-53(57)47-38-29-23-17-14-20-26-32-41-50-56(4,51-42-33-27-21-15-18-24-30-39-48-54(58)45-36-12-9-6-2)52-43-34-28-22-16-19-25-31-40-49-55(59)46-37-13-10-7-3/h29-31,38-40,53-55,57-59H,5-28,32-37,41-52H2,1-4H3/q+1/t53-,54-,55-,56?/m1/s1 |
| InChIKey | QJZMRYRYLXVDLJ-IHUHJQABSA-N |
| XLogP | 16.46 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.47 |
| LogP ≤ 5 | 16.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|