C17H30O2 — CID 54232249
12-methoxy-5,9,12-trimethyltrideca-4,6-dien-3-one (PubChem CID 54232249) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is 12-methoxy-5,9,12-trimethyltrideca-4,6-dien-3-one.
| Compound Name | 12-methoxy-5,9,12-trimethyltrideca-4,6-dien-3-one |
|---|---|
| PubChem CID | 54232249 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 12-methoxy-5,9,12-trimethyltrideca-4,6-dien-3-one |
| SMILES | CCC(=O)C=C(C)C=CCC(C)CCC(C)(C)OC |
| InChI | InChI=1S/C17H30O2/c1-7-16(18)13-15(3)10-8-9-14(2)11-12-17(4,5)19-6/h8,10,13-14H,7,9,11-12H2,1-6H3 |
| InChIKey | QKCDJQTYWBDSOX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|