About hex-3-enyl 3-oxo-4-propylsulfanylbutanoate
hex-3-enyl 3-oxo-4-propylsulfanylbutanoate (PubChem CID 54232258) has the molecular formula C13H22O3S
and a molecular weight of 258.38 g/mol. Its IUPAC name is hex-3-enyl 3-oxo-4-propylsulfanylbutanoate.
Molecular Properties
| Compound Name | hex-3-enyl 3-oxo-4-propylsulfanylbutanoate |
| PubChem CID | 54232258 |
| Molecular Formula | C13H22O3S |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | hex-3-enyl 3-oxo-4-propylsulfanylbutanoate |
| SMILES | CCC=CCCOC(=O)CC(=O)CSCCC |
| InChI | InChI=1S/C13H22O3S/c1-3-5-6-7-8-16-13(15)10-12(14)11-17-9-4-2/h5-6H,3-4,7-11H2,1-2H3 |
| InChIKey | QKCJLWYYDPNGCK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hex-3-enyl 3-oxo-4-propylsulfanylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-3-enyl 3-oxo-4-propylsulfanylbutanoate?
The IUPAC name of hex-3-enyl 3-oxo-4-propylsulfanylbutanoate (CID 54232258) is hex-3-enyl 3-oxo-4-propylsulfanylbutanoate.
What is the SMILES notation for hex-3-enyl 3-oxo-4-propylsulfanylbutanoate?
The canonical SMILES for hex-3-enyl 3-oxo-4-propylsulfanylbutanoate is CCC=CCCOC(=O)CC(=O)CSCCC.
What is the InChIKey of hex-3-enyl 3-oxo-4-propylsulfanylbutanoate?
The InChIKey is QKCJLWYYDPNGCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O3S/c1-3-5-6-7-8-16-13(15)10-12(14)11-17-9-4-2/h5-6H,3-4,7-11H2,1-2H3.
What are the key properties of hex-3-enyl 3-oxo-4-propylsulfanylbutanoate?
hex-3-enyl 3-oxo-4-propylsulfanylbutanoate has a molecular weight of 258.38 g/mol, XLogP of 2.99, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hex-3-enyl 3-oxo-4-propylsulfanylbutanoate is sourced from PubChem (CID 54232258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).