About 4-[2-(2-butoxyethoxy)ethyl]-1,2-dichlorobenzene
4-[2-(2-butoxyethoxy)ethyl]-1,2-dichlorobenzene (PubChem CID 54232462) has the molecular formula C14H20Cl2O2
and a molecular weight of 291.22 g/mol. Its IUPAC name is 4-[2-(2-butoxyethoxy)ethyl]-1,2-dichlorobenzene.
Molecular Properties
| Compound Name | 4-[2-(2-butoxyethoxy)ethyl]-1,2-dichlorobenzene |
| PubChem CID | 54232462 |
| Molecular Formula | C14H20Cl2O2 |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 4-[2-(2-butoxyethoxy)ethyl]-1,2-dichlorobenzene |
| SMILES | CCCCOCCOCCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H20Cl2O2/c1-2-3-7-17-9-10-18-8-6-12-4-5-13(15)14(16)11-12/h4-5,11H,2-3,6-10H2,1H3 |
| InChIKey | NVOADKZGEOPEII-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(2-butoxyethoxy)ethyl]-1,2-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2-butoxyethoxy)ethyl]-1,2-dichlorobenzene?
The IUPAC name of 4-[2-(2-butoxyethoxy)ethyl]-1,2-dichlorobenzene (CID 54232462) is 4-[2-(2-butoxyethoxy)ethyl]-1,2-dichlorobenzene.
What is the SMILES notation for 4-[2-(2-butoxyethoxy)ethyl]-1,2-dichlorobenzene?
The canonical SMILES for 4-[2-(2-butoxyethoxy)ethyl]-1,2-dichlorobenzene is CCCCOCCOCCc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 4-[2-(2-butoxyethoxy)ethyl]-1,2-dichlorobenzene?
The InChIKey is NVOADKZGEOPEII-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20Cl2O2/c1-2-3-7-17-9-10-18-8-6-12-4-5-13(15)14(16)11-12/h4-5,11H,2-3,6-10H2,1H3.
What are the key properties of 4-[2-(2-butoxyethoxy)ethyl]-1,2-dichlorobenzene?
4-[2-(2-butoxyethoxy)ethyl]-1,2-dichlorobenzene has a molecular weight of 291.22 g/mol, XLogP of 4.37, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2-butoxyethoxy)ethyl]-1,2-dichlorobenzene is sourced from PubChem (CID 54232462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).