C11H22N2O — CID 54232552
N-(1,2,2,6,6-pentamethylpiperidin-4-yl)formamide (PubChem CID 54232552) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is N-(1,2,2,6,6-pentamethylpiperidin-4-yl)formamide.
| Compound Name | N-(1,2,2,6,6-pentamethylpiperidin-4-yl)formamide |
|---|---|
| PubChem CID | 54232552 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | N-(1,2,2,6,6-pentamethylpiperidin-4-yl)formamide |
| SMILES | CC1(CC(CC(N1C)(C)C)NC=O)C |
| InChI | InChI=1S/C11H22N2O/c1-10(2)6-9(12-8-14)7-11(3,4)13(10)5/h8-9H,6-7H2,1-5H3,(H,12,14) |
| InChIKey | UQPPXIOQNZZYIK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 32.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | 205 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|