About 2-(2-nitroethenyl)-1,3-diazinane
2-(2-nitroethenyl)-1,3-diazinane (PubChem CID 54232571) has the molecular formula C6H11N3O2
and a molecular weight of 157.17 g/mol. Its IUPAC name is 2-(2-nitroethenyl)-1,3-diazinane.
Molecular Properties
| Compound Name | 2-(2-nitroethenyl)-1,3-diazinane |
| PubChem CID | 54232571 |
| Molecular Formula | C6H11N3O2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 2-(2-nitroethenyl)-1,3-diazinane |
| SMILES | O=[N+]([O-])C=CC1NCCCN1 |
| InChI | InChI=1S/C6H11N3O2/c10-9(11)5-2-6-7-3-1-4-8-6/h2,5-8H,1,3-4H2 |
| InChIKey | WYNQCPHYBIWVGZ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-nitroethenyl)-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-nitroethenyl)-1,3-diazinane?
The IUPAC name of 2-(2-nitroethenyl)-1,3-diazinane (CID 54232571) is 2-(2-nitroethenyl)-1,3-diazinane.
What is the SMILES notation for 2-(2-nitroethenyl)-1,3-diazinane?
The canonical SMILES for 2-(2-nitroethenyl)-1,3-diazinane is O=[N+]([O-])C=CC1NCCCN1.
What is the InChIKey of 2-(2-nitroethenyl)-1,3-diazinane?
The InChIKey is WYNQCPHYBIWVGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O2/c10-9(11)5-2-6-7-3-1-4-8-6/h2,5-8H,1,3-4H2.
What are the key properties of 2-(2-nitroethenyl)-1,3-diazinane?
2-(2-nitroethenyl)-1,3-diazinane has a molecular weight of 157.17 g/mol, XLogP of -0.31, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-nitroethenyl)-1,3-diazinane is sourced from PubChem (CID 54232571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).