C44H58N2O7 — CID 54232826
[(2R,3S,5R,6R)-6-(6-aminohexoxy)-5-(2,2-dimethyl-3-phenylpropanoyl)oxy-2-(hydroxymethyl)-6-[2-(1H-indol-3-yl)ethyl]oxan-3-yl] 2,2-dimethyl-3-phenylpropanoate (PubChem CID 54232826) has the molecular formula C44H58N2O7 and a molecular weight of 726.96 g/mol. Its IUPAC name is [(2R,3S,5R,6R)-6-(6-aminohexoxy)-5-(2,2-dimethyl-3-phenylpropanoyl)oxy-2-(hydroxymethyl)-6-[2-(1H-indol-3-yl)ethyl]oxan-3-yl] 2,2-dimethyl-3-phenylpropanoate.
| Compound Name | [(2R,3S,5R,6R)-6-(6-aminohexoxy)-5-(2,2-dimethyl-3-phenylpropanoyl)oxy-2-(hydroxymethyl)-6-[2-(1H-indol-3-yl)ethyl]oxan-3-yl] 2,2-dimethyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 54232826 |
| Molecular Formula | C44H58N2O7 |
| Molecular Weight | 726.96 g/mol |
| Exact Mass | 726.42 |
| IUPAC Name | [(2R,3S,5R,6R)-6-(6-aminohexoxy)-5-(2,2-dimethyl-3-phenylpropanoyl)oxy-2-(hydroxymethyl)-6-[2-(1H-indol-3-yl)ethyl]oxan-3-yl] 2,2-dimethyl-3-phenylpropanoate |
| SMILES | CC(C)(Cc1ccccc1)C(=O)O[C@H]1C[C@@H](OC(=O)C(C)(C)Cc2ccccc2)[C@](CCc2c[nH]c3ccccc23)(OCCCCCCN)O[C@@H]1CO |
| InChI | InChI=1S/C44H58N2O7/c1-42(2,28-32-17-9-7-10-18-32)40(48)51-37-27-39(52-41(49)43(3,4)29-33-19-11-8-12-20-33)44(53-38(37)31-47,50-26-16-6-5-15-25-45)24-23-34-30-46-36-22-14-13-21-35(34)36/h7-14,17-22,30,37-39,46-47H,5-6,15-16,23-29,31,45H2,1-4H3/t37-,38+,39+,44+/m0/s1 |
| InChIKey | QKLOFTHEMMGMOF-UAPZKSIPSA-N |
| XLogP | 7.48 |
| TPSA | 133.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.96 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|