C40H24F6O3 — CID 54232930
1-[9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluoren-2-yl]-5-phenylpenta-2,4-dien-1-one (PubChem CID 54232930) has the molecular formula C40H24F6O3 and a molecular weight of 666.62 g/mol. Its IUPAC name is 1-[9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluoren-2-yl]-5-phenylpenta-2,4-dien-1-one.
| Compound Name | 1-[9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluoren-2-yl]-5-phenylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 54232930 |
| Molecular Formula | C40H24F6O3 |
| Molecular Weight | 666.62 g/mol |
| Exact Mass | 666.16 |
| IUPAC Name | 1-[9,9-bis[4-(1,2,2-trifluoroethenoxy)phenyl]fluoren-2-yl]-5-phenylpenta-2,4-dien-1-one |
| SMILES | O=C(C=CC=Cc1ccccc1)c1ccc2c(c1)C(c1ccc(OC(F)=C(F)F)cc1)(c1ccc(OC(F)=C(F)F)cc1)c1ccccc1-2 |
| InChI | InChI=1S/C40H24F6O3/c41-36(42)38(45)48-29-19-15-27(16-20-29)40(28-17-21-30(22-18-28)49-39(46)37(43)44)33-12-6-5-11-31(33)32-23-14-26(24-34(32)40)35(47)13-7-4-10-25-8-2-1-3-9-25/h1-24H |
| InChIKey | QKNNLXKTFSUXTL-UHFFFAOYSA-N |
| XLogP | 11.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.62 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|