C16H33FO2Si — CID 54233189
7-[dimethyl(2-methylpentan-2-yl)silyl]oxy-4-fluoro-2-methylhept-4-en-3-ol (PubChem CID 54233189) has the molecular formula C16H33FO2Si and a molecular weight of 304.52 g/mol. Its IUPAC name is 7-[dimethyl(2-methylpentan-2-yl)silyl]oxy-4-fluoro-2-methylhept-4-en-3-ol.
| Compound Name | 7-[dimethyl(2-methylpentan-2-yl)silyl]oxy-4-fluoro-2-methylhept-4-en-3-ol |
|---|---|
| PubChem CID | 54233189 |
| Molecular Formula | C16H33FO2Si |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 7-[dimethyl(2-methylpentan-2-yl)silyl]oxy-4-fluoro-2-methylhept-4-en-3-ol |
| SMILES | CCCC(C)(C)[Si](C)(C)OCCC=C(F)C(O)C(C)C |
| InChI | InChI=1S/C16H33FO2Si/c1-8-11-16(4,5)20(6,7)19-12-9-10-14(17)15(18)13(2)3/h10,13,15,18H,8-9,11-12H2,1-7H3 |
| InChIKey | QKSAESBDBORHHW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|