C22H33IO2 — CID 54233915
2-[(8S,9S,10R,13S,14S)-3-iodo-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoic acid (PubChem CID 54233915) has the molecular formula C22H33IO2 and a molecular weight of 456.41 g/mol. Its IUPAC name is 2-[(8S,9S,10R,13S,14S)-3-iodo-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoic acid.
| Compound Name | 2-[(8S,9S,10R,13S,14S)-3-iodo-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoic acid |
|---|---|
| PubChem CID | 54233915 |
| Molecular Formula | C22H33IO2 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 2-[(8S,9S,10R,13S,14S)-3-iodo-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoic acid |
| SMILES | CC(C(=O)O)C1CC[C@H]2[C@@H]3CC=C4CC(I)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H33IO2/c1-13(20(24)25)17-6-7-18-16-5-4-14-12-15(23)8-10-21(14,2)19(16)9-11-22(17,18)3/h4,13,15-19H,5-12H2,1-3H3,(H,24,25)/t13?,15?,16-,17?,18-,19-,21-,22+/m0/s1 |
| InChIKey | QLESMOJOJIZGHO-ZDEVZFKMSA-N |
| XLogP | 6.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|