C9H12F6O — CID 54233939
1,2,2,3,3,3-hexafluoropropoxycyclohexane (PubChem CID 54233939) has the molecular formula C9H12F6O and a molecular weight of 250.18 g/mol. Its IUPAC name is 1,2,2,3,3,3-hexafluoropropoxycyclohexane.
| Compound Name | 1,2,2,3,3,3-hexafluoropropoxycyclohexane |
|---|---|
| PubChem CID | 54233939 |
| Molecular Formula | C9H12F6O |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 1,2,2,3,3,3-hexafluoropropoxycyclohexane |
| SMILES | FC(OC1CCCCC1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H12F6O/c10-7(8(11,12)9(13,14)15)16-6-4-2-1-3-5-6/h6-7H,1-5H2 |
| InChIKey | SKLWYZXBMCOPQT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|