About 3H-pyrrole-4,5-dione
3H-pyrrole-4,5-dione (PubChem CID 54234144) has the molecular formula C4H3NO2
and a molecular weight of 97.07 g/mol. Its IUPAC name is 3H-pyrrole-4,5-dione.
Molecular Properties
| Compound Name | 3H-pyrrole-4,5-dione |
| PubChem CID | 54234144 |
| Molecular Formula | C4H3NO2 |
| Molecular Weight | 97.07 g/mol |
| Exact Mass | 97.02 |
| IUPAC Name | 3H-pyrrole-4,5-dione |
| SMILES | O=C1CC=NC1=O |
| InChI | InChI=1S/C4H3NO2/c6-3-1-2-5-4(3)7/h2H,1H2 |
| InChIKey | QLILJMYXMPWURR-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.07 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3H-pyrrole-4,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-pyrrole-4,5-dione?
The IUPAC name of 3H-pyrrole-4,5-dione (CID 54234144) is 3H-pyrrole-4,5-dione.
What is the SMILES notation for 3H-pyrrole-4,5-dione?
The canonical SMILES for 3H-pyrrole-4,5-dione is O=C1CC=NC1=O.
What is the InChIKey of 3H-pyrrole-4,5-dione?
The InChIKey is QLILJMYXMPWURR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3NO2/c6-3-1-2-5-4(3)7/h2H,1H2.
What are the key properties of 3H-pyrrole-4,5-dione?
3H-pyrrole-4,5-dione has a molecular weight of 97.07 g/mol, XLogP of -0.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-pyrrole-4,5-dione is sourced from PubChem (CID 54234144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).