C39H14F24O5 — CID 54234259
3,4,5-tris[3,5-bis(trifluoromethyl)phenoxy]-2-[3,5-bis(trifluoromethyl)phenyl]benzoic acid (PubChem CID 54234259) has the molecular formula C39H14F24O5 and a molecular weight of 1018.49 g/mol. Its IUPAC name is 3,4,5-tris[3,5-bis(trifluoromethyl)phenoxy]-2-[3,5-bis(trifluoromethyl)phenyl]benzoic acid.
| Compound Name | 3,4,5-tris[3,5-bis(trifluoromethyl)phenoxy]-2-[3,5-bis(trifluoromethyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 54234259 |
| Molecular Formula | C39H14F24O5 |
| Molecular Weight | 1018.49 g/mol |
| Exact Mass | 1018.05 |
| IUPAC Name | 3,4,5-tris[3,5-bis(trifluoromethyl)phenoxy]-2-[3,5-bis(trifluoromethyl)phenyl]benzoic acid |
| SMILES | O=C(O)c1cc(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C39H14F24O5/c40-32(41,42)15-1-14(2-16(3-15)33(43,44)45)28-26(31(64)65)13-27(66-23-7-17(34(46,47)48)4-18(8-23)35(49,50)51)29(67-24-9-19(36(52,53)54)5-20(10-24)37(55,56)57)30(28)68-25-11-21(38(58,59)60)6-22(12-25)39(61,62)63/h1-13H,(H,64,65) |
| InChIKey | QLKHEPXROZECFP-UHFFFAOYSA-N |
| XLogP | 16.58 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1018.49 |
| LogP ≤ 5 | 16.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |