About [2-(2-methylsulfanylethyl)-1,3-dioxolan-4-yl]methanol
[2-(2-methylsulfanylethyl)-1,3-dioxolan-4-yl]methanol (PubChem CID 54234311) has the molecular formula C7H14O3S
and a molecular weight of 178.25 g/mol. Its IUPAC name is [2-(2-methylsulfanylethyl)-1,3-dioxolan-4-yl]methanol.
Molecular Properties
| Compound Name | [2-(2-methylsulfanylethyl)-1,3-dioxolan-4-yl]methanol |
| PubChem CID | 54234311 |
| Molecular Formula | C7H14O3S |
| Molecular Weight | 178.25 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | [2-(2-methylsulfanylethyl)-1,3-dioxolan-4-yl]methanol |
| SMILES | CSCCC1OCC(CO)O1 |
| InChI | InChI=1S/C7H14O3S/c1-11-3-2-7-9-5-6(4-8)10-7/h6-8H,2-5H2,1H3 |
| InChIKey | QLLANIRWBAMTCC-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.25 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(2-methylsulfanylethyl)-1,3-dioxolan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-methylsulfanylethyl)-1,3-dioxolan-4-yl]methanol?
The IUPAC name of [2-(2-methylsulfanylethyl)-1,3-dioxolan-4-yl]methanol (CID 54234311) is [2-(2-methylsulfanylethyl)-1,3-dioxolan-4-yl]methanol.
What is the SMILES notation for [2-(2-methylsulfanylethyl)-1,3-dioxolan-4-yl]methanol?
The canonical SMILES for [2-(2-methylsulfanylethyl)-1,3-dioxolan-4-yl]methanol is CSCCC1OCC(CO)O1.
What is the InChIKey of [2-(2-methylsulfanylethyl)-1,3-dioxolan-4-yl]methanol?
The InChIKey is QLLANIRWBAMTCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O3S/c1-11-3-2-7-9-5-6(4-8)10-7/h6-8H,2-5H2,1H3.
What are the key properties of [2-(2-methylsulfanylethyl)-1,3-dioxolan-4-yl]methanol?
[2-(2-methylsulfanylethyl)-1,3-dioxolan-4-yl]methanol has a molecular weight of 178.25 g/mol, XLogP of 0.47, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-methylsulfanylethyl)-1,3-dioxolan-4-yl]methanol is sourced from PubChem (CID 54234311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).