C12H19NO3 — CID 54234569
butyl (3S,3aS)-5-oxo-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylate (PubChem CID 54234569) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is butyl (3S,3aS)-5-oxo-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylate.
| Compound Name | butyl (3S,3aS)-5-oxo-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 54234569 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | butyl (3S,3aS)-5-oxo-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylate |
| SMILES | CCCCOC(=O)[C@H]1NCC2CC(=O)C[C@@H]21 |
| InChI | InChI=1S/C12H19NO3/c1-2-3-4-16-12(15)11-10-6-9(14)5-8(10)7-13-11/h8,10-11,13H,2-7H2,1H3/t8?,10-,11-/m0/s1 |
| InChIKey | QLQFYPGQOOQXMQ-CSUXEGHOSA-N |
| XLogP | 0.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|