C19H29NO5 — CID 54234762
[6-hexyl-1,5-bis(hydroxymethyl)-4-phenyl-2,7-dioxa-5-azabicyclo[2.2.1]heptan-6-yl]methanol (PubChem CID 54234762) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is [6-hexyl-1,5-bis(hydroxymethyl)-4-phenyl-2,7-dioxa-5-azabicyclo[2.2.1]heptan-6-yl]methanol.
| Compound Name | [6-hexyl-1,5-bis(hydroxymethyl)-4-phenyl-2,7-dioxa-5-azabicyclo[2.2.1]heptan-6-yl]methanol |
|---|---|
| PubChem CID | 54234762 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | [6-hexyl-1,5-bis(hydroxymethyl)-4-phenyl-2,7-dioxa-5-azabicyclo[2.2.1]heptan-6-yl]methanol |
| SMILES | CCCCCCC1(CO)N(CO)C2(c3ccccc3)COC1(CO)O2 |
| InChI | InChI=1S/C19H29NO5/c1-2-3-4-8-11-17(12-21)19(13-22)24-14-18(25-19,20(17)15-23)16-9-6-5-7-10-16/h5-7,9-10,21-23H,2-4,8,11-15H2,1H3 |
| InChIKey | KNNOJHPRTYEURF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|