C20H36O3Si2 — CID 54234765
2,5,5-trimethyl-1-(3-methyl-5-trimethylsilyloxypent-3-en-1-ynyl)-4-trimethylsilyloxycyclopent-2-en-1-ol (PubChem CID 54234765) has the molecular formula C20H36O3Si2 and a molecular weight of 380.68 g/mol. Its IUPAC name is 2,5,5-trimethyl-1-(3-methyl-5-trimethylsilyloxypent-3-en-1-ynyl)-4-trimethylsilyloxycyclopent-2-en-1-ol.
| Compound Name | 2,5,5-trimethyl-1-(3-methyl-5-trimethylsilyloxypent-3-en-1-ynyl)-4-trimethylsilyloxycyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 54234765 |
| Molecular Formula | C20H36O3Si2 |
| Molecular Weight | 380.68 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 2,5,5-trimethyl-1-(3-methyl-5-trimethylsilyloxypent-3-en-1-ynyl)-4-trimethylsilyloxycyclopent-2-en-1-ol |
| SMILES | CC(C#CC1(O)C(C)=CC(O[Si](C)(C)C)C1(C)C)=CCO[Si](C)(C)C |
| InChI | InChI=1S/C20H36O3Si2/c1-16(12-14-22-24(5,6)7)11-13-20(21)17(2)15-18(19(20,3)4)23-25(8,9)10/h12,15,18,21H,14H2,1-10H3 |
| InChIKey | QLTOMLUJRPSRHE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.68 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|