C12H22O10 — CID 54235325
(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxy-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]hexan-1-one (PubChem CID 54235325) has the molecular formula C12H22O10 and a molecular weight of 326.30 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxy-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]hexan-1-one.
| Compound Name | (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxy-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]hexan-1-one |
|---|---|
| PubChem CID | 54235325 |
| Molecular Formula | C12H22O10 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxy-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]hexan-1-one |
| SMILES | C[C@H]1OC(C(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H22O10/c1-3-5(15)7(17)10(20)12(22-3)11(21)9(19)8(18)6(16)4(14)2-13/h3-10,12-20H,2H2,1H3/t3-,4-,5+,6+,7+,8+,9-,10-,12?/m1/s1 |
| InChIKey | QMDPAEWMWMZYOS-LKSFBTKESA-N |
| XLogP | -5.14 |
| TPSA | 188.14 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | -5.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |