C31H30O7S — CID 54236070
[(2R,3S,4S)-3,4-dihydroxy-1-oxo-5-trityloxypentan-2-yl] 4-methylbenzenesulfonate (PubChem CID 54236070) has the molecular formula C31H30O7S and a molecular weight of 546.64 g/mol. Its IUPAC name is [(2R,3S,4S)-3,4-dihydroxy-1-oxo-5-trityloxypentan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S,4S)-3,4-dihydroxy-1-oxo-5-trityloxypentan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 54236070 |
| Molecular Formula | C31H30O7S |
| Molecular Weight | 546.64 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | [(2R,3S,4S)-3,4-dihydroxy-1-oxo-5-trityloxypentan-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H](C=O)[C@@H](O)[C@@H](O)COC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H30O7S/c1-23-17-19-27(20-18-23)39(35,36)38-29(21-32)30(34)28(33)22-37-31(24-11-5-2-6-12-24,25-13-7-3-8-14-25)26-15-9-4-10-16-26/h2-21,28-30,33-34H,22H2,1H3/t28-,29-,30-/m0/s1 |
| InChIKey | QMQSVDQCFXTXAH-DTXPUJKBSA-N |
| XLogP | 4.00 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.64 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|