About 5-ethoxy-2,3-bis[[(2S)-1-methylazetidin-2-yl]methoxy]pyridine
5-ethoxy-2,3-bis[[(2S)-1-methylazetidin-2-yl]methoxy]pyridine (PubChem CID 54236193) has the molecular formula C17H27N3O3
and a molecular weight of 321.42 g/mol. Its IUPAC name is 5-ethoxy-2,3-bis[[(2S)-1-methylazetidin-2-yl]methoxy]pyridine.
Molecular Properties
| Compound Name | 5-ethoxy-2,3-bis[[(2S)-1-methylazetidin-2-yl]methoxy]pyridine |
| PubChem CID | 54236193 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 5-ethoxy-2,3-bis[[(2S)-1-methylazetidin-2-yl]methoxy]pyridine |
| SMILES | CCOc1cnc(OC[C@@H]2CCN2C)c(OC[C@@H]2CCN2C)c1 |
| InChI | InChI=1S/C17H27N3O3/c1-4-21-15-9-16(22-11-13-5-7-19(13)2)17(18-10-15)23-12-14-6-8-20(14)3/h9-10,13-14H,4-8,11-12H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | QMSXQNSKVYGSEJ-KBPBESRZSA-N |
| XLogP | 1.65 |
| TPSA | 47.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-ethoxy-2,3-bis[[(2S)-1-methylazetidin-2-yl]methoxy]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-2,3-bis[[(2S)-1-methylazetidin-2-yl]methoxy]pyridine?
The IUPAC name of 5-ethoxy-2,3-bis[[(2S)-1-methylazetidin-2-yl]methoxy]pyridine (CID 54236193) is 5-ethoxy-2,3-bis[[(2S)-1-methylazetidin-2-yl]methoxy]pyridine.
What is the SMILES notation for 5-ethoxy-2,3-bis[[(2S)-1-methylazetidin-2-yl]methoxy]pyridine?
The canonical SMILES for 5-ethoxy-2,3-bis[[(2S)-1-methylazetidin-2-yl]methoxy]pyridine is CCOc1cnc(OC[C@@H]2CCN2C)c(OC[C@@H]2CCN2C)c1.
What is the InChIKey of 5-ethoxy-2,3-bis[[(2S)-1-methylazetidin-2-yl]methoxy]pyridine?
The InChIKey is QMSXQNSKVYGSEJ-KBPBESRZSA-N. The full InChI is InChI=1S/C17H27N3O3/c1-4-21-15-9-16(22-11-13-5-7-19(13)2)17(18-10-15)23-12-14-6-8-20(14)3/h9-10,13-14H,4-8,11-12H2,1-3H3/t13-,14-/m0/s1.
What are the key properties of 5-ethoxy-2,3-bis[[(2S)-1-methylazetidin-2-yl]methoxy]pyridine?
5-ethoxy-2,3-bis[[(2S)-1-methylazetidin-2-yl]methoxy]pyridine has a molecular weight of 321.42 g/mol, XLogP of 1.65, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-2,3-bis[[(2S)-1-methylazetidin-2-yl]methoxy]pyridine is sourced from PubChem (CID 54236193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).