About 4-methyloct-4-en-1,7-diyn-3-ol
4-methyloct-4-en-1,7-diyn-3-ol (PubChem CID 54236197) has the molecular formula C9H10O
and a molecular weight of 134.18 g/mol. Its IUPAC name is 4-methyloct-4-en-1,7-diyn-3-ol.
Molecular Properties
| Compound Name | 4-methyloct-4-en-1,7-diyn-3-ol |
| PubChem CID | 54236197 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | 4-methyloct-4-en-1,7-diyn-3-ol |
| SMILES | C#CCC=C(C)C(O)C#C |
| InChI | InChI=1S/C9H10O/c1-4-6-7-8(3)9(10)5-2/h1-2,7,9-10H,6H2,3H3 |
| InChIKey | QMSYFNBRKYPTKN-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyloct-4-en-1,7-diyn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyloct-4-en-1,7-diyn-3-ol?
The IUPAC name of 4-methyloct-4-en-1,7-diyn-3-ol (CID 54236197) is 4-methyloct-4-en-1,7-diyn-3-ol.
What is the SMILES notation for 4-methyloct-4-en-1,7-diyn-3-ol?
The canonical SMILES for 4-methyloct-4-en-1,7-diyn-3-ol is C#CCC=C(C)C(O)C#C.
What is the InChIKey of 4-methyloct-4-en-1,7-diyn-3-ol?
The InChIKey is QMSYFNBRKYPTKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O/c1-4-6-7-8(3)9(10)5-2/h1-2,7,9-10H,6H2,3H3.
What are the key properties of 4-methyloct-4-en-1,7-diyn-3-ol?
4-methyloct-4-en-1,7-diyn-3-ol has a molecular weight of 134.18 g/mol, XLogP of 0.95, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyloct-4-en-1,7-diyn-3-ol is sourced from PubChem (CID 54236197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).