C11H8F6O — CID 54236329
1,1,1,2,3,3-hexafluoro-5-phenylpent-4-en-2-ol (PubChem CID 54236329) has the molecular formula C11H8F6O and a molecular weight of 270.17 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-5-phenylpent-4-en-2-ol.
| Compound Name | 1,1,1,2,3,3-hexafluoro-5-phenylpent-4-en-2-ol |
|---|---|
| PubChem CID | 54236329 |
| Molecular Formula | C11H8F6O |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-5-phenylpent-4-en-2-ol |
| SMILES | OC(F)(C(F)(F)F)C(F)(F)C=Cc1ccccc1 |
| InChI | InChI=1S/C11H8F6O/c12-9(13,10(14,18)11(15,16)17)7-6-8-4-2-1-3-5-8/h1-7,18H |
| InChIKey | QMVILTHKCPMEMG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |