C28H27N3O2 — CID 54236373
3-benzoyl-5-(4-benzylpiperidin-1-yl)-1H-indole-2-carboxamide (PubChem CID 54236373) has the molecular formula C28H27N3O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is 3-benzoyl-5-(4-benzylpiperidin-1-yl)-1H-indole-2-carboxamide.
| Compound Name | 3-benzoyl-5-(4-benzylpiperidin-1-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 54236373 |
| Molecular Formula | C28H27N3O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 3-benzoyl-5-(4-benzylpiperidin-1-yl)-1H-indole-2-carboxamide |
| SMILES | NC(=O)c1[nH]c2ccc(N3CCC(Cc4ccccc4)CC3)cc2c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C28H27N3O2/c29-28(33)26-25(27(32)21-9-5-2-6-10-21)23-18-22(11-12-24(23)30-26)31-15-13-20(14-16-31)17-19-7-3-1-4-8-19/h1-12,18,20,30H,13-17H2,(H2,29,33) |
| InChIKey | QMWDBQVGKUOECA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |