C10H9F5O — CID 54236481
1-methyl-4-(1,1,2,2,3-pentafluoropropoxy)benzene (PubChem CID 54236481) has the molecular formula C10H9F5O and a molecular weight of 240.17 g/mol. Its IUPAC name is 1-methyl-4-(1,1,2,2,3-pentafluoropropoxy)benzene.
| Compound Name | 1-methyl-4-(1,1,2,2,3-pentafluoropropoxy)benzene |
|---|---|
| PubChem CID | 54236481 |
| Molecular Formula | C10H9F5O |
| Molecular Weight | 240.17 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 1-methyl-4-(1,1,2,2,3-pentafluoropropoxy)benzene |
| SMILES | Cc1ccc(OC(F)(F)C(F)(F)CF)cc1 |
| InChI | InChI=1S/C10H9F5O/c1-7-2-4-8(5-3-7)16-10(14,15)9(12,13)6-11/h2-5H,6H2,1H3 |
| InChIKey | KVQGHDFPSWVTBJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.17 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|