C26H36ClN3O3 — CID 54237223
(7S)-4-[2-butoxy-3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol (PubChem CID 54237223) has the molecular formula C26H36ClN3O3 and a molecular weight of 474.05 g/mol. Its IUPAC name is (7S)-4-[2-butoxy-3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol.
| Compound Name | (7S)-4-[2-butoxy-3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol |
|---|---|
| PubChem CID | 54237223 |
| Molecular Formula | C26H36ClN3O3 |
| Molecular Weight | 474.05 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | (7S)-4-[2-butoxy-3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol |
| SMILES | CCCCOC(CN1CCN(c2cccc(Cl)c2)CC1)Cn1c(O)c2c(c1O)[C@H]1CCC2C1 |
| InChI | InChI=1S/C26H36ClN3O3/c1-2-3-13-33-22(16-28-9-11-29(12-10-28)21-6-4-5-20(27)15-21)17-30-25(31)23-18-7-8-19(14-18)24(23)26(30)32/h4-6,15,18-19,22,31-32H,2-3,7-14,16-17H2,1H3/t18-,19?,22?/m0/s1 |
| InChIKey | QNKJKWWXLZVBBQ-PGFLUOATSA-N |
| XLogP | 4.92 |
| TPSA | 61.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.05 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|