C18H38O2 — CID 54237347
2,4,4-trimethyl-2-(2,4,4-trimethylhexan-2-ylperoxy)hexane (PubChem CID 54237347) has the molecular formula C18H38O2 and a molecular weight of 286.50 g/mol. Its IUPAC name is 2,4,4-trimethyl-2-(2,4,4-trimethylhexan-2-ylperoxy)hexane.
| Compound Name | 2,4,4-trimethyl-2-(2,4,4-trimethylhexan-2-ylperoxy)hexane |
|---|---|
| PubChem CID | 54237347 |
| Molecular Formula | C18H38O2 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.29 |
| IUPAC Name | 2,4,4-trimethyl-2-(2,4,4-trimethylhexan-2-ylperoxy)hexane |
| SMILES | CCC(C)(C)CC(C)(C)OOC(C)(C)CC(C)(C)CC |
| InChI | InChI=1S/C18H38O2/c1-11-15(3,4)13-17(7,8)19-20-18(9,10)14-16(5,6)12-2/h11-14H2,1-10H3 |
| InChIKey | QNMPDHZAHJEFTO-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|