About 4-amino-5-cyclohexyl-2,2-difluoro-1-propan-2-ylsulfanylpentan-3-one
4-amino-5-cyclohexyl-2,2-difluoro-1-propan-2-ylsulfanylpentan-3-one (PubChem CID 54237408) has the molecular formula C14H25F2NOS
and a molecular weight of 293.42 g/mol. Its IUPAC name is 4-amino-5-cyclohexyl-2,2-difluoro-1-propan-2-ylsulfanylpentan-3-one.
Molecular Properties
| Compound Name | 4-amino-5-cyclohexyl-2,2-difluoro-1-propan-2-ylsulfanylpentan-3-one |
| PubChem CID | 54237408 |
| Molecular Formula | C14H25F2NOS |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 4-amino-5-cyclohexyl-2,2-difluoro-1-propan-2-ylsulfanylpentan-3-one |
| SMILES | CC(C)SCC(F)(F)C(=O)C(N)CC1CCCCC1 |
| InChI | InChI=1S/C14H25F2NOS/c1-10(2)19-9-14(15,16)13(18)12(17)8-11-6-4-3-5-7-11/h10-12H,3-9,17H2,1-2H3 |
| InChIKey | QNNUZLBGDZFFJO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-5-cyclohexyl-2,2-difluoro-1-propan-2-ylsulfanylpentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5-cyclohexyl-2,2-difluoro-1-propan-2-ylsulfanylpentan-3-one?
The IUPAC name of 4-amino-5-cyclohexyl-2,2-difluoro-1-propan-2-ylsulfanylpentan-3-one (CID 54237408) is 4-amino-5-cyclohexyl-2,2-difluoro-1-propan-2-ylsulfanylpentan-3-one.
What is the SMILES notation for 4-amino-5-cyclohexyl-2,2-difluoro-1-propan-2-ylsulfanylpentan-3-one?
The canonical SMILES for 4-amino-5-cyclohexyl-2,2-difluoro-1-propan-2-ylsulfanylpentan-3-one is CC(C)SCC(F)(F)C(=O)C(N)CC1CCCCC1.
What is the InChIKey of 4-amino-5-cyclohexyl-2,2-difluoro-1-propan-2-ylsulfanylpentan-3-one?
The InChIKey is QNNUZLBGDZFFJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25F2NOS/c1-10(2)19-9-14(15,16)13(18)12(17)8-11-6-4-3-5-7-11/h10-12H,3-9,17H2,1-2H3.
What are the key properties of 4-amino-5-cyclohexyl-2,2-difluoro-1-propan-2-ylsulfanylpentan-3-one?
4-amino-5-cyclohexyl-2,2-difluoro-1-propan-2-ylsulfanylpentan-3-one has a molecular weight of 293.42 g/mol, XLogP of 3.63, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-cyclohexyl-2,2-difluoro-1-propan-2-ylsulfanylpentan-3-one is sourced from PubChem (CID 54237408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).